C9H10F3IN2O2 — CID 66340651
5-iodo-6-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 66340651) has the molecular formula C9H10F3IN2O2 and a molecular weight of 362.09 g/mol. Its IUPAC name is 5-iodo-6-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 5-iodo-6-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 66340651 |
| Molecular Formula | C9H10F3IN2O2 |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-iodo-6-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | Cc1ncn(CCOCC(F)(F)F)c(=O)c1I |
| InChI | InChI=1S/C9H10F3IN2O2/c1-6-7(13)8(16)15(5-14-6)2-3-17-4-9(10,11)12/h5H,2-4H2,1H3 |
| InChIKey | KPPXMCHPVGODCW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|