About 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one
5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 66340699) has the molecular formula C9H10F3IN2O2
and a molecular weight of 362.09 g/mol. Its IUPAC name is 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| PubChem CID | 66340699 |
| Molecular Formula | C9H10F3IN2O2 |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | Cc1ncc(I)c(=O)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H10F3IN2O2/c1-6-14-4-7(13)8(16)15(6)2-3-17-5-9(10,11)12/h4H,2-3,5H2,1H3 |
| InChIKey | DCQKKHZCHSDBSL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one?
The IUPAC name of 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (CID 66340699) is 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
What is the SMILES notation for 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one?
The canonical SMILES for 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one is Cc1ncc(I)c(=O)n1CCOCC(F)(F)F.
What is the InChIKey of 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one?
The InChIKey is DCQKKHZCHSDBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3IN2O2/c1-6-14-4-7(13)8(16)15(6)2-3-17-5-9(10,11)12/h4H,2-3,5H2,1H3.
What are the key properties of 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one?
5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one has a molecular weight of 362.09 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one is sourced from PubChem (CID 66340699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).