C13H16ClIN4O — CID 66341157
3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-5-iodo-2-methylpyrimidin-4-one (PubChem CID 66341157) has the molecular formula C13H16ClIN4O and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-5-iodo-2-methylpyrimidin-4-one.
| Compound Name | 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-5-iodo-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66341157 |
| Molecular Formula | C13H16ClIN4O |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-5-iodo-2-methylpyrimidin-4-one |
| SMILES | CCc1nn(CC)c(Cn2c(C)ncc(I)c2=O)c1Cl |
| InChI | InChI=1S/C13H16ClIN4O/c1-4-10-12(14)11(19(5-2)17-10)7-18-8(3)16-6-9(15)13(18)20/h6H,4-5,7H2,1-3H3 |
| InChIKey | CHHVNAQQADIRFO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|