About 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane
4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane (PubChem CID 66343303) has the molecular formula C14H25BrO2
and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane.
Molecular Properties
| Compound Name | 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane |
| PubChem CID | 66343303 |
| Molecular Formula | C14H25BrO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane |
| SMILES | CCC1(CC)C(Br)CC1OCC1CCOCC1 |
| InChI | InChI=1S/C14H25BrO2/c1-3-14(4-2)12(15)9-13(14)17-10-11-5-7-16-8-6-11/h11-13H,3-10H2,1-2H3 |
| InChIKey | FSOJBZXVRIHWGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane?
The IUPAC name of 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane (CID 66343303) is 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane.
What is the SMILES notation for 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane?
The canonical SMILES for 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane is CCC1(CC)C(Br)CC1OCC1CCOCC1.
What is the InChIKey of 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane?
The InChIKey is FSOJBZXVRIHWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25BrO2/c1-3-14(4-2)12(15)9-13(14)17-10-11-5-7-16-8-6-11/h11-13H,3-10H2,1-2H3.
What are the key properties of 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane?
4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane has a molecular weight of 305.26 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-2,2-diethylcyclobutyl)oxymethyl]oxane is sourced from PubChem (CID 66343303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).