About (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane
(3-chloro-2,2-diethylcyclobutyl)oxycyclopentane (PubChem CID 66343398) has the molecular formula C13H23ClO
and a molecular weight of 230.78 g/mol. Its IUPAC name is (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane.
Molecular Properties
| Compound Name | (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane |
| PubChem CID | 66343398 |
| Molecular Formula | C13H23ClO |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane |
| SMILES | CCC1(CC)C(Cl)CC1OC1CCCC1 |
| InChI | InChI=1S/C13H23ClO/c1-3-13(4-2)11(14)9-12(13)15-10-7-5-6-8-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | NMRNDMJWUGHPIM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane?
The IUPAC name of (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane (CID 66343398) is (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane.
What is the SMILES notation for (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane?
The canonical SMILES for (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane is CCC1(CC)C(Cl)CC1OC1CCCC1.
What is the InChIKey of (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane?
The InChIKey is NMRNDMJWUGHPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23ClO/c1-3-13(4-2)11(14)9-12(13)15-10-7-5-6-8-10/h10-12H,3-9H2,1-2H3.
What are the key properties of (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane?
(3-chloro-2,2-diethylcyclobutyl)oxycyclopentane has a molecular weight of 230.78 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2,2-diethylcyclobutyl)oxycyclopentane is sourced from PubChem (CID 66343398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).