About 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline
8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline (PubChem CID 66343452) has the molecular formula C18H22BrNO
and a molecular weight of 348.28 g/mol. Its IUPAC name is 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline.
Molecular Properties
| Compound Name | 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline |
| PubChem CID | 66343452 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline |
| SMILES | CCC1(CC)C(Br)CC1Oc1cccc2ccc(C)nc12 |
| InChI | InChI=1S/C18H22BrNO/c1-4-18(5-2)15(19)11-16(18)21-14-8-6-7-13-10-9-12(3)20-17(13)14/h6-10,15-16H,4-5,11H2,1-3H3 |
| InChIKey | SWWYONKWXLPQRV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline?
The IUPAC name of 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline (CID 66343452) is 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline.
What is the SMILES notation for 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline?
The canonical SMILES for 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline is CCC1(CC)C(Br)CC1Oc1cccc2ccc(C)nc12.
What is the InChIKey of 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline?
The InChIKey is SWWYONKWXLPQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrNO/c1-4-18(5-2)15(19)11-16(18)21-14-8-6-7-13-10-9-12(3)20-17(13)14/h6-10,15-16H,4-5,11H2,1-3H3.
What are the key properties of 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline?
8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline has a molecular weight of 348.28 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-bromo-2,2-diethylcyclobutyl)oxy-2-methylquinoline is sourced from PubChem (CID 66343452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).