C15H27ClO — CID 66345749
3-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,1,5-trimethylcyclohexane (PubChem CID 66345749) has the molecular formula C15H27ClO and a molecular weight of 258.83 g/mol. Its IUPAC name is 3-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,1,5-trimethylcyclohexane.
| Compound Name | 3-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 66345749 |
| Molecular Formula | C15H27ClO |
| Molecular Weight | 258.83 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,1,5-trimethylcyclohexane |
| SMILES | CC1CC(OC2CC(Cl)C2(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H27ClO/c1-10-6-11(9-14(2,3)8-10)17-13-7-12(16)15(13,4)5/h10-13H,6-9H2,1-5H3 |
| InChIKey | OCOCRXAXUACUNH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|