C14H16Cl4O — CID 66345754
1,3,5-trichloro-2-(3-chloro-2,2-diethylcyclobutyl)oxybenzene (PubChem CID 66345754) has the molecular formula C14H16Cl4O and a molecular weight of 342.09 g/mol. Its IUPAC name is 1,3,5-trichloro-2-(3-chloro-2,2-diethylcyclobutyl)oxybenzene.
| Compound Name | 1,3,5-trichloro-2-(3-chloro-2,2-diethylcyclobutyl)oxybenzene |
|---|---|
| PubChem CID | 66345754 |
| Molecular Formula | C14H16Cl4O |
| Molecular Weight | 342.09 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1,3,5-trichloro-2-(3-chloro-2,2-diethylcyclobutyl)oxybenzene |
| SMILES | CCC1(CC)C(Cl)CC1Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl4O/c1-3-14(4-2)11(18)7-12(14)19-13-9(16)5-8(15)6-10(13)17/h5-6,11-12H,3-4,7H2,1-2H3 |
| InChIKey | JODSBZRWMKLVBK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.09 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|