About 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane
3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane (PubChem CID 66345993) has the molecular formula C14H15BrCl2O
and a molecular weight of 350.08 g/mol. Its IUPAC name is 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane.
Molecular Properties
| Compound Name | 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane |
| PubChem CID | 66345993 |
| Molecular Formula | C14H15BrCl2O |
| Molecular Weight | 350.08 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane |
| SMILES | Clc1ccc(OC2CC(Br)C23CCCC3)cc1Cl |
| InChI | InChI=1S/C14H15BrCl2O/c15-12-8-13(14(12)5-1-2-6-14)18-9-3-4-10(16)11(17)7-9/h3-4,7,12-13H,1-2,5-6,8H2 |
| InChIKey | RNBYSCHJKMTDCP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.08 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane?
The IUPAC name of 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane (CID 66345993) is 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane.
What is the SMILES notation for 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane?
The canonical SMILES for 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane is Clc1ccc(OC2CC(Br)C23CCCC3)cc1Cl.
What is the InChIKey of 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane?
The InChIKey is RNBYSCHJKMTDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrCl2O/c15-12-8-13(14(12)5-1-2-6-14)18-9-3-4-10(16)11(17)7-9/h3-4,7,12-13H,1-2,5-6,8H2.
What are the key properties of 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane?
3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane has a molecular weight of 350.08 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(3,4-dichlorophenoxy)spiro[3.4]octane is sourced from PubChem (CID 66345993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).