About 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene
2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene (PubChem CID 66346241) has the molecular formula C18H27BrO
and a molecular weight of 339.32 g/mol. Its IUPAC name is 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
| PubChem CID | 66346241 |
| Molecular Formula | C18H27BrO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1OC1CC(Br)C1(C)C |
| InChI | InChI=1S/C18H27BrO/c1-11(2)13-8-7-9-14(12(3)4)17(13)20-16-10-15(19)18(16,5)6/h7-9,11-12,15-16H,10H2,1-6H3 |
| InChIKey | JMTFEACRPVRDHM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene (CID 66346241) is 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene is CC(C)c1cccc(C(C)C)c1OC1CC(Br)C1(C)C.
What is the InChIKey of 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The InChIKey is JMTFEACRPVRDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27BrO/c1-11(2)13-8-7-9-14(12(3)4)17(13)20-16-10-15(19)18(16,5)6/h7-9,11-12,15-16H,10H2,1-6H3.
What are the key properties of 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene has a molecular weight of 339.32 g/mol, XLogP of 5.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2,2-dimethylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 66346241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).