About 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene
2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene (PubChem CID 66346383) has the molecular formula C13H14BrCl3O
and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene |
| PubChem CID | 66346383 |
| Molecular Formula | C13H14BrCl3O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene |
| SMILES | CCC1(C)C(Br)CC1Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14BrCl3O/c1-3-13(2)10(14)6-11(13)18-12-8(16)4-7(15)5-9(12)17/h4-5,10-11H,3,6H2,1-2H3 |
| InChIKey | FXXUKEMOVYXNEW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene?
The IUPAC name of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene (CID 66346383) is 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene.
What is the SMILES notation for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene?
The canonical SMILES for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene is CCC1(C)C(Br)CC1Oc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene?
The InChIKey is FXXUKEMOVYXNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrCl3O/c1-3-13(2)10(14)6-11(13)18-12-8(16)4-7(15)5-9(12)17/h4-5,10-11H,3,6H2,1-2H3.
What are the key properties of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene?
2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene has a molecular weight of 372.52 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3,5-trichlorobenzene is sourced from PubChem (CID 66346383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).