C19H29BrO — CID 66346442
2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene (PubChem CID 66346442) has the molecular formula C19H29BrO and a molecular weight of 353.34 g/mol. Its IUPAC name is 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 66346442 |
| Molecular Formula | C19H29BrO |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
| SMILES | CCC1(C)C(Br)CC1Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H29BrO/c1-7-19(6)16(20)11-17(19)21-18-14(12(2)3)9-8-10-15(18)13(4)5/h8-10,12-13,16-17H,7,11H2,1-6H3 |
| InChIKey | ALRIYJTVMOMXKL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|