About 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene
2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene (PubChem CID 66346442) has the molecular formula C19H29BrO
and a molecular weight of 353.34 g/mol. Its IUPAC name is 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
| PubChem CID | 66346442 |
| Molecular Formula | C19H29BrO |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene |
| SMILES | CCC1(C)C(Br)CC1Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H29BrO/c1-7-19(6)16(20)11-17(19)21-18-14(12(2)3)9-8-10-15(18)13(4)5/h8-10,12-13,16-17H,7,11H2,1-6H3 |
| InChIKey | ALRIYJTVMOMXKL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene (CID 66346442) is 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene is CCC1(C)C(Br)CC1Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
The InChIKey is ALRIYJTVMOMXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29BrO/c1-7-19(6)16(20)11-17(19)21-18-14(12(2)3)9-8-10-15(18)13(4)5/h8-10,12-13,16-17H,7,11H2,1-6H3.
What are the key properties of 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene?
2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene has a molecular weight of 353.34 g/mol, XLogP of 6.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-ethyl-2-methylcyclobutyl)oxy-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 66346442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).