About (3-bromo-2,2-dimethylcyclobutyl)oxybenzene
(3-bromo-2,2-dimethylcyclobutyl)oxybenzene (PubChem CID 66346516) has the molecular formula C12H15BrO
and a molecular weight of 255.16 g/mol. Its IUPAC name is (3-bromo-2,2-dimethylcyclobutyl)oxybenzene.
Molecular Properties
| Compound Name | (3-bromo-2,2-dimethylcyclobutyl)oxybenzene |
| PubChem CID | 66346516 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (3-bromo-2,2-dimethylcyclobutyl)oxybenzene |
| SMILES | CC1(C)C(Br)CC1Oc1ccccc1 |
| InChI | InChI=1S/C12H15BrO/c1-12(2)10(13)8-11(12)14-9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3 |
| InChIKey | BOJGUOYMTHBHNQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-2,2-dimethylcyclobutyl)oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,2-dimethylcyclobutyl)oxybenzene?
The IUPAC name of (3-bromo-2,2-dimethylcyclobutyl)oxybenzene (CID 66346516) is (3-bromo-2,2-dimethylcyclobutyl)oxybenzene.
What is the SMILES notation for (3-bromo-2,2-dimethylcyclobutyl)oxybenzene?
The canonical SMILES for (3-bromo-2,2-dimethylcyclobutyl)oxybenzene is CC1(C)C(Br)CC1Oc1ccccc1.
What is the InChIKey of (3-bromo-2,2-dimethylcyclobutyl)oxybenzene?
The InChIKey is BOJGUOYMTHBHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO/c1-12(2)10(13)8-11(12)14-9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3.
What are the key properties of (3-bromo-2,2-dimethylcyclobutyl)oxybenzene?
(3-bromo-2,2-dimethylcyclobutyl)oxybenzene has a molecular weight of 255.16 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,2-dimethylcyclobutyl)oxybenzene is sourced from PubChem (CID 66346516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).