C14H22N2OS — CID 66348834
N,N-dimethyl-2-[3-(propylaminomethyl)phenyl]sulfanylacetamide (PubChem CID 66348834) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(propylaminomethyl)phenyl]sulfanylacetamide.
| Compound Name | N,N-dimethyl-2-[3-(propylaminomethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 66348834 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N,N-dimethyl-2-[3-(propylaminomethyl)phenyl]sulfanylacetamide |
| SMILES | CCCNCc1cccc(SCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H22N2OS/c1-4-8-15-10-12-6-5-7-13(9-12)18-11-14(17)16(2)3/h5-7,9,15H,4,8,10-11H2,1-3H3 |
| InChIKey | QYBNOLUTEPPFMU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|