C19H33NS — CID 66349477
2-methyl-N-[(3-octylsulfanylphenyl)methyl]propan-2-amine (PubChem CID 66349477) has the molecular formula C19H33NS and a molecular weight of 307.55 g/mol. Its IUPAC name is 2-methyl-N-[(3-octylsulfanylphenyl)methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[(3-octylsulfanylphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 66349477 |
| Molecular Formula | C19H33NS |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-methyl-N-[(3-octylsulfanylphenyl)methyl]propan-2-amine |
| SMILES | CCCCCCCCSc1cccc(CNC(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NS/c1-5-6-7-8-9-10-14-21-18-13-11-12-17(15-18)16-20-19(2,3)4/h11-13,15,20H,5-10,14,16H2,1-4H3 |
| InChIKey | YBJUDFVVHBNPBV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|