About 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile
2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile (PubChem CID 66350871) has the molecular formula C11H11N3S
and a molecular weight of 217.30 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile |
| PubChem CID | 66350871 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N)n(-c2ccsc2)c1C |
| InChI | InChI=1S/C11H11N3S/c1-7-8(2)14(9-3-4-15-6-9)11(13)10(7)5-12/h3-4,6H,13H2,1-2H3 |
| InChIKey | CNCDZXJHIIJJFO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile?
The IUPAC name of 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile (CID 66350871) is 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile.
What is the SMILES notation for 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile?
The canonical SMILES for 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile is Cc1c(C#N)c(N)n(-c2ccsc2)c1C.
What is the InChIKey of 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile?
The InChIKey is CNCDZXJHIIJJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3S/c1-7-8(2)14(9-3-4-15-6-9)11(13)10(7)5-12/h3-4,6H,13H2,1-2H3.
What are the key properties of 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile?
2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile has a molecular weight of 217.30 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethyl-1-thiophen-3-ylpyrrole-3-carbonitrile is sourced from PubChem (CID 66350871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).