C17H27NOS — CID 66351553
N-ethyl-3-(thiophen-2-ylmethoxy)spiro[3.6]decan-1-amine (PubChem CID 66351553) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is N-ethyl-3-(thiophen-2-ylmethoxy)spiro[3.6]decan-1-amine.
| Compound Name | N-ethyl-3-(thiophen-2-ylmethoxy)spiro[3.6]decan-1-amine |
|---|---|
| PubChem CID | 66351553 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-ethyl-3-(thiophen-2-ylmethoxy)spiro[3.6]decan-1-amine |
| SMILES | CCNC1CC(OCc2cccs2)C12CCCCCC2 |
| InChI | InChI=1S/C17H27NOS/c1-2-18-15-12-16(19-13-14-8-7-11-20-14)17(15)9-5-3-4-6-10-17/h7-8,11,15-16,18H,2-6,9-10,12-13H2,1H3 |
| InChIKey | CAZJWQJBLWYTMR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |