C10H12N4O3S — CID 66351697
1-(4-nitropyrazol-1-yl)-3-(thiophen-3-ylamino)propan-2-ol (PubChem CID 66351697) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-3-(thiophen-3-ylamino)propan-2-ol.
| Compound Name | 1-(4-nitropyrazol-1-yl)-3-(thiophen-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 66351697 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-3-(thiophen-3-ylamino)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNc2ccsc2)c1 |
| InChI | InChI=1S/C10H12N4O3S/c15-10(4-11-8-1-2-18-7-8)6-13-5-9(3-12-13)14(16)17/h1-3,5,7,10-11,15H,4,6H2 |
| InChIKey | NLYBWSAAUVMHLA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|