C12H19NOS — CID 66351892
2-ethyl-2-methyl-N-thiophen-3-yloxan-4-amine (PubChem CID 66351892) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-ethyl-2-methyl-N-thiophen-3-yloxan-4-amine.
| Compound Name | 2-ethyl-2-methyl-N-thiophen-3-yloxan-4-amine |
|---|---|
| PubChem CID | 66351892 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-ethyl-2-methyl-N-thiophen-3-yloxan-4-amine |
| SMILES | CCC1(C)CC(Nc2ccsc2)CCO1 |
| InChI | InChI=1S/C12H19NOS/c1-3-12(2)8-10(4-6-14-12)13-11-5-7-15-9-11/h5,7,9-10,13H,3-4,6,8H2,1-2H3 |
| InChIKey | OHQIVCNTDOUWNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |