C11H18N2OS — CID 66352154
1-pyrrolidin-1-yl-3-(thiophen-3-ylamino)propan-2-ol (PubChem CID 66352154) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-3-(thiophen-3-ylamino)propan-2-ol.
| Compound Name | 1-pyrrolidin-1-yl-3-(thiophen-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 66352154 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-pyrrolidin-1-yl-3-(thiophen-3-ylamino)propan-2-ol |
| SMILES | OC(CNc1ccsc1)CN1CCCC1 |
| InChI | InChI=1S/C11H18N2OS/c14-11(8-13-4-1-2-5-13)7-12-10-3-6-15-9-10/h3,6,9,11-12,14H,1-2,4-5,7-8H2 |
| InChIKey | ZFSLRPBDTXYWHS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |