About [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine
[3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine (PubChem CID 66353686) has the molecular formula C12H14N2S2
and a molecular weight of 250.39 g/mol. Its IUPAC name is [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine |
| PubChem CID | 66353686 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine |
| SMILES | Cc1ncc(CSc2cccc(CN)c2)s1 |
| InChI | InChI=1S/C12H14N2S2/c1-9-14-7-12(16-9)8-15-11-4-2-3-10(5-11)6-13/h2-5,7H,6,8,13H2,1H3 |
| InChIKey | UIDQHRUZOBEQPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine?
The IUPAC name of [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine (CID 66353686) is [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine.
What is the SMILES notation for [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine?
The canonical SMILES for [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine is Cc1ncc(CSc2cccc(CN)c2)s1.
What is the InChIKey of [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine?
The InChIKey is UIDQHRUZOBEQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S2/c1-9-14-7-12(16-9)8-15-11-4-2-3-10(5-11)6-13/h2-5,7H,6,8,13H2,1H3.
What are the key properties of [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine?
[3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine has a molecular weight of 250.39 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]phenyl]methanamine is sourced from PubChem (CID 66353686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).