About N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine
N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine (PubChem CID 66354069) has the molecular formula C14H19ClN2S
and a molecular weight of 282.84 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine |
| PubChem CID | 66354069 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine |
| SMILES | CCC(CC)N(CCCl)c1snc2ccccc12 |
| InChI | InChI=1S/C14H19ClN2S/c1-3-11(4-2)17(10-9-15)14-12-7-5-6-8-13(12)16-18-14/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | QYYVDJJKMZEUJL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine?
The IUPAC name of N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine (CID 66354069) is N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine.
What is the SMILES notation for N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine?
The canonical SMILES for N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine is CCC(CC)N(CCCl)c1snc2ccccc12.
What is the InChIKey of N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine?
The InChIKey is QYYVDJJKMZEUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2S/c1-3-11(4-2)17(10-9-15)14-12-7-5-6-8-13(12)16-18-14/h5-8,11H,3-4,9-10H2,1-2H3.
What are the key properties of N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine?
N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine has a molecular weight of 282.84 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N-pentan-3-yl-2,1-benzothiazol-3-amine is sourced from PubChem (CID 66354069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).