C10H11N3S — CID 66354556
6-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraen-8-ylhydrazine (PubChem CID 66354556) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 6-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraen-8-ylhydrazine.
| Compound Name | 6-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraen-8-ylhydrazine |
|---|---|
| PubChem CID | 66354556 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),4,8-tetraen-8-ylhydrazine |
| SMILES | NNc1c2c(nc3ccsc13)CCC2 |
| InChI | InChI=1S/C10H11N3S/c11-13-9-6-2-1-3-7(6)12-8-4-5-14-10(8)9/h4-5H,1-3,11H2,(H,12,13) |
| InChIKey | BGQGAYAVRUOHDN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|