About 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine
5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine (PubChem CID 66354976) has the molecular formula C10H10F2N2S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine |
| PubChem CID | 66354976 |
| Molecular Formula | C10H10F2N2S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine |
| SMILES | CCNc1cc(C(F)F)nc2ccsc12 |
| InChI | InChI=1S/C10H10F2N2S/c1-2-13-7-5-8(10(11)12)14-6-3-4-15-9(6)7/h3-5,10H,2H2,1H3,(H,13,14) |
| InChIKey | SOJHPTAAKQEWKN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine?
The IUPAC name of 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine (CID 66354976) is 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine?
The canonical SMILES for 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine is CCNc1cc(C(F)F)nc2ccsc12.
What is the InChIKey of 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine?
The InChIKey is SOJHPTAAKQEWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2S/c1-2-13-7-5-8(10(11)12)14-6-3-4-15-9(6)7/h3-5,10H,2H2,1H3,(H,13,14).
What are the key properties of 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine?
5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine has a molecular weight of 228.27 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-N-ethylthieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 66354976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).