C10H14N2O3S — CID 66355244
2-[methyl(thiophen-3-ylcarbamoyl)amino]butanoic acid (PubChem CID 66355244) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[methyl(thiophen-3-ylcarbamoyl)amino]butanoic acid.
| Compound Name | 2-[methyl(thiophen-3-ylcarbamoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 66355244 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-[methyl(thiophen-3-ylcarbamoyl)amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)Nc1ccsc1 |
| InChI | InChI=1S/C10H14N2O3S/c1-3-8(9(13)14)12(2)10(15)11-7-4-5-16-6-7/h4-6,8H,3H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | FPTHIKFJSYVUMQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |