About 9-butyl-1,8-dimethyl-3H-purine-2,6-dione
9-butyl-1,8-dimethyl-3H-purine-2,6-dione (PubChem CID 663553) has the molecular formula C11H16N4O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 9-butyl-1,8-dimethyl-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 9-butyl-1,8-dimethyl-3H-purine-2,6-dione |
| PubChem CID | 663553 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 9-butyl-1,8-dimethyl-3H-purine-2,6-dione |
| SMILES | CCCCn1c(C)nc2c(=O)n(C)c(=O)[nH]c21 |
| InChI | InChI=1S/C11H16N4O2/c1-4-5-6-15-7(2)12-8-9(15)13-11(17)14(3)10(8)16/h4-6H2,1-3H3,(H,13,17) |
| InChIKey | HYYRLSAEMYVRFQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-butyl-1,8-dimethyl-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-1,8-dimethyl-3H-purine-2,6-dione?
The IUPAC name of 9-butyl-1,8-dimethyl-3H-purine-2,6-dione (CID 663553) is 9-butyl-1,8-dimethyl-3H-purine-2,6-dione.
What is the SMILES notation for 9-butyl-1,8-dimethyl-3H-purine-2,6-dione?
The canonical SMILES for 9-butyl-1,8-dimethyl-3H-purine-2,6-dione is CCCCn1c(C)nc2c(=O)n(C)c(=O)[nH]c21.
What is the InChIKey of 9-butyl-1,8-dimethyl-3H-purine-2,6-dione?
The InChIKey is HYYRLSAEMYVRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c1-4-5-6-15-7(2)12-8-9(15)13-11(17)14(3)10(8)16/h4-6H2,1-3H3,(H,13,17).
What are the key properties of 9-butyl-1,8-dimethyl-3H-purine-2,6-dione?
9-butyl-1,8-dimethyl-3H-purine-2,6-dione has a molecular weight of 236.27 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-1,8-dimethyl-3H-purine-2,6-dione is sourced from PubChem (CID 663553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).