About 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol
3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol (PubChem CID 66355737) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol |
| PubChem CID | 66355737 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol |
| SMILES | CN(CC1CC(O)C1)c1snc2ccccc12 |
| InChI | InChI=1S/C13H16N2OS/c1-15(8-9-6-10(16)7-9)13-11-4-2-3-5-12(11)14-17-13/h2-5,9-10,16H,6-8H2,1H3 |
| InChIKey | BVDLSZDUAFZGAN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol?
The IUPAC name of 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol (CID 66355737) is 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol.
What is the SMILES notation for 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol?
The canonical SMILES for 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol is CN(CC1CC(O)C1)c1snc2ccccc12.
What is the InChIKey of 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol?
The InChIKey is BVDLSZDUAFZGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-15(8-9-6-10(16)7-9)13-11-4-2-3-5-12(11)14-17-13/h2-5,9-10,16H,6-8H2,1H3.
What are the key properties of 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol?
3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol has a molecular weight of 248.35 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,1-benzothiazol-3-yl(methyl)amino]methyl]cyclobutan-1-ol is sourced from PubChem (CID 66355737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).