C10H15NS — CID 66356001
(3-propylsulfanylphenyl)methanamine (PubChem CID 66356001) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is (3-propylsulfanylphenyl)methanamine.
| Compound Name | (3-propylsulfanylphenyl)methanamine |
|---|---|
| PubChem CID | 66356001 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (3-propylsulfanylphenyl)methanamine |
| SMILES | CCCSc1cccc(CN)c1 |
| InChI | InChI=1S/C10H15NS/c1-2-6-12-10-5-3-4-9(7-10)8-11/h3-5,7H,2,6,8,11H2,1H3 |
| InChIKey | QNMDTKLHXXAGLR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |