About [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine
[4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine (PubChem CID 66356378) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine.
Molecular Properties
| Compound Name | [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine |
| PubChem CID | 66356378 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine |
| SMILES | COc1cc(CN)ccc1Oc1snc2ccccc12 |
| InChI | InChI=1S/C15H14N2O2S/c1-18-14-8-10(9-16)6-7-13(14)19-15-11-4-2-3-5-12(11)17-20-15/h2-8H,9,16H2,1H3 |
| InChIKey | JMCTYMMIDJNMON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine?
The IUPAC name of [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine (CID 66356378) is [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine.
What is the SMILES notation for [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine?
The canonical SMILES for [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine is COc1cc(CN)ccc1Oc1snc2ccccc12.
What is the InChIKey of [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine?
The InChIKey is JMCTYMMIDJNMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-18-14-8-10(9-16)6-7-13(14)19-15-11-4-2-3-5-12(11)17-20-15/h2-8H,9,16H2,1H3.
What are the key properties of [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine?
[4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine has a molecular weight of 286.36 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,1-benzothiazol-3-yloxy)-3-methoxyphenyl]methanamine is sourced from PubChem (CID 66356378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).