About 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine
3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine (PubChem CID 66357548) has the molecular formula C17H26ClNO
and a molecular weight of 295.85 g/mol. Its IUPAC name is 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine |
| PubChem CID | 66357548 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine |
| SMILES | CCNC1CC(Oc2c(C)cc(Cl)cc2C)C1(C)CC |
| InChI | InChI=1S/C17H26ClNO/c1-6-17(5)14(19-7-2)10-15(17)20-16-11(3)8-13(18)9-12(16)4/h8-9,14-15,19H,6-7,10H2,1-5H3 |
| InChIKey | MVDYTWRIKQIAQE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine?
The IUPAC name of 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine (CID 66357548) is 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine.
What is the SMILES notation for 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine?
The canonical SMILES for 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine is CCNC1CC(Oc2c(C)cc(Cl)cc2C)C1(C)CC.
What is the InChIKey of 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine?
The InChIKey is MVDYTWRIKQIAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClNO/c1-6-17(5)14(19-7-2)10-15(17)20-16-11(3)8-13(18)9-12(16)4/h8-9,14-15,19H,6-7,10H2,1-5H3.
What are the key properties of 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine?
3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine has a molecular weight of 295.85 g/mol, XLogP of 4.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,6-dimethylphenoxy)-N,2-diethyl-2-methylcyclobutan-1-amine is sourced from PubChem (CID 66357548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).