C19H20BrN7O2 — CID 663582
7-[(3-bromophenyl)methyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione (PubChem CID 663582) has the molecular formula C19H20BrN7O2 and a molecular weight of 458.32 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(3-bromophenyl)methyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 663582 |
| Molecular Formula | C19H20BrN7O2 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NCCCn1ccnc1)n2Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H20BrN7O2/c1-25-16-15(17(28)24-19(25)29)27(11-13-4-2-5-14(20)10-13)18(23-16)22-6-3-8-26-9-7-21-12-26/h2,4-5,7,9-10,12H,3,6,8,11H2,1H3,(H,22,23)(H,24,28,29) |
| InChIKey | YYVSVNOLFFJYOH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|