C18H25NO — CID 66358625
3-(2,3-dihydro-1H-inden-5-yloxy)spiro[3.5]nonan-1-amine (PubChem CID 66358625) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yloxy)spiro[3.5]nonan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yloxy)spiro[3.5]nonan-1-amine |
|---|---|
| PubChem CID | 66358625 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yloxy)spiro[3.5]nonan-1-amine |
| SMILES | NC1CC(Oc2ccc3c(c2)CCC3)C12CCCCC2 |
| InChI | InChI=1S/C18H25NO/c19-16-12-17(18(16)9-2-1-3-10-18)20-15-8-7-13-5-4-6-14(13)11-15/h7-8,11,16-17H,1-6,9-10,12,19H2 |
| InChIKey | DKJXICWMMUGOJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |