C13H16I3NO — CID 66358655
N-propyl-3-(2,4,6-triiodophenoxy)cyclobutan-1-amine (PubChem CID 66358655) has the molecular formula C13H16I3NO and a molecular weight of 582.99 g/mol. Its IUPAC name is N-propyl-3-(2,4,6-triiodophenoxy)cyclobutan-1-amine.
| Compound Name | N-propyl-3-(2,4,6-triiodophenoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 66358655 |
| Molecular Formula | C13H16I3NO |
| Molecular Weight | 582.99 g/mol |
| Exact Mass | 582.84 |
| IUPAC Name | N-propyl-3-(2,4,6-triiodophenoxy)cyclobutan-1-amine |
| SMILES | CCCNC1CC(Oc2c(I)cc(I)cc2I)C1 |
| InChI | InChI=1S/C13H16I3NO/c1-2-3-17-9-6-10(7-9)18-13-11(15)4-8(14)5-12(13)16/h4-5,9-10,17H,2-3,6-7H2,1H3 |
| InChIKey | SIRGKPVTCSHADR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|