C17H24ClNO — CID 66359072
3-(4-chloro-3,5-dimethylphenoxy)-N-methylspiro[3.4]octan-1-amine (PubChem CID 66359072) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylphenoxy)-N-methylspiro[3.4]octan-1-amine.
| Compound Name | 3-(4-chloro-3,5-dimethylphenoxy)-N-methylspiro[3.4]octan-1-amine |
|---|---|
| PubChem CID | 66359072 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylphenoxy)-N-methylspiro[3.4]octan-1-amine |
| SMILES | CNC1CC(Oc2cc(C)c(Cl)c(C)c2)C12CCCC2 |
| InChI | InChI=1S/C17H24ClNO/c1-11-8-13(9-12(2)16(11)18)20-15-10-14(19-3)17(15)6-4-5-7-17/h8-9,14-15,19H,4-7,10H2,1-3H3 |
| InChIKey | HBJQKMIQYWPPFV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |