About 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane
3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane (PubChem CID 66359302) has the molecular formula C12H18BrF3O
and a molecular weight of 315.17 g/mol. Its IUPAC name is 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane.
Molecular Properties
| Compound Name | 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane |
| PubChem CID | 66359302 |
| Molecular Formula | C12H18BrF3O |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane |
| SMILES | CC(OC1CC(Br)C12CCCCC2)C(F)(F)F |
| InChI | InChI=1S/C12H18BrF3O/c1-8(12(14,15)16)17-10-7-9(13)11(10)5-3-2-4-6-11/h8-10H,2-7H2,1H3 |
| InChIKey | KDJHRKLUPQAYOH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane?
The IUPAC name of 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane (CID 66359302) is 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane.
What is the SMILES notation for 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane?
The canonical SMILES for 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane is CC(OC1CC(Br)C12CCCCC2)C(F)(F)F.
What is the InChIKey of 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane?
The InChIKey is KDJHRKLUPQAYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrF3O/c1-8(12(14,15)16)17-10-7-9(13)11(10)5-3-2-4-6-11/h8-10H,2-7H2,1H3.
What are the key properties of 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane?
3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane has a molecular weight of 315.17 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(1,1,1-trifluoropropan-2-yloxy)spiro[3.5]nonane is sourced from PubChem (CID 66359302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).