About 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol
3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol (PubChem CID 66360930) has the molecular formula C17H17FO2
and a molecular weight of 272.32 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol |
| PubChem CID | 66360930 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol |
| SMILES | OCC(CC1Cc2cc(F)ccc2O1)c1ccccc1 |
| InChI | InChI=1S/C17H17FO2/c18-15-6-7-17-13(8-15)9-16(20-17)10-14(11-19)12-4-2-1-3-5-12/h1-8,14,16,19H,9-11H2 |
| InChIKey | KWJMQUXOFNFGRK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol?
The IUPAC name of 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol (CID 66360930) is 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol.
What is the SMILES notation for 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol?
The canonical SMILES for 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol is OCC(CC1Cc2cc(F)ccc2O1)c1ccccc1.
What is the InChIKey of 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol?
The InChIKey is KWJMQUXOFNFGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FO2/c18-15-6-7-17-13(8-15)9-16(20-17)10-14(11-19)12-4-2-1-3-5-12/h1-8,14,16,19H,9-11H2.
What are the key properties of 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol?
3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol has a molecular weight of 272.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)-2-phenylpropan-1-ol is sourced from PubChem (CID 66360930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).