About [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol
[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol (PubChem CID 66361064) has the molecular formula C12H12BrN3O2
and a molecular weight of 310.15 g/mol. Its IUPAC name is [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol |
| PubChem CID | 66361064 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CC2Cc3cc(Br)ccc3O2)nn1 |
| InChI | InChI=1S/C12H12BrN3O2/c13-9-1-2-12-8(3-9)4-11(18-12)6-16-5-10(7-17)14-15-16/h1-3,5,11,17H,4,6-7H2 |
| InChIKey | FOKVWNPEIYFGDZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol?
The IUPAC name of [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol (CID 66361064) is [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol is OCc1cn(CC2Cc3cc(Br)ccc3O2)nn1.
What is the InChIKey of [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol?
The InChIKey is FOKVWNPEIYFGDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN3O2/c13-9-1-2-12-8(3-9)4-11(18-12)6-16-5-10(7-17)14-15-16/h1-3,5,11,17H,4,6-7H2.
What are the key properties of [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol?
[1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol has a molecular weight of 310.15 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]triazol-4-yl]methanol is sourced from PubChem (CID 66361064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).