About 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid
2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid (PubChem CID 66362290) has the molecular formula C15H12BrNO3S
and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid |
| PubChem CID | 66362290 |
| Molecular Formula | C15H12BrNO3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(SCC2Cc3cc(Br)ccc3O2)c1 |
| InChI | InChI=1S/C15H12BrNO3S/c16-11-1-2-13-10(5-11)6-12(20-13)8-21-14-7-9(15(18)19)3-4-17-14/h1-5,7,12H,6,8H2,(H,18,19) |
| InChIKey | IXMSLMHUUPYTMI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid?
The IUPAC name of 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid (CID 66362290) is 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid.
What is the SMILES notation for 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid?
The canonical SMILES for 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid is O=C(O)c1ccnc(SCC2Cc3cc(Br)ccc3O2)c1.
What is the InChIKey of 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid?
The InChIKey is IXMSLMHUUPYTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO3S/c16-11-1-2-13-10(5-11)6-12(20-13)8-21-14-7-9(15(18)19)3-4-17-14/h1-5,7,12H,6,8H2,(H,18,19).
What are the key properties of 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid?
2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid has a molecular weight of 366.24 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]pyridine-4-carboxylic acid is sourced from PubChem (CID 66362290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).