C16H22O5 — CID 6636232
[(2R,3S,6S)-3-acetyloxy-6-hex-1-ynyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 6636232) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-hex-1-ynyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-hex-1-ynyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6636232 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-hex-1-ynyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCC#C[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C16H22O5/c1-4-5-6-7-8-14-9-10-15(20-13(3)18)16(21-14)11-19-12(2)17/h9-10,14-16H,4-6,11H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | QDENTLMYBDGBCI-OWCLPIDISA-N |
| XLogP | 2.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|