About [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol
[2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (PubChem CID 66362374) has the molecular formula C14H15BrN2O2S
and a molecular weight of 355.26 g/mol. Its IUPAC name is [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| PubChem CID | 66362374 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol |
| SMILES | Cn1c(CO)cnc1SCC1Cc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C14H15BrN2O2S/c1-17-11(7-18)6-16-14(17)20-8-12-5-9-4-10(15)2-3-13(9)19-12/h2-4,6,12,18H,5,7-8H2,1H3 |
| InChIKey | FJPQJXGHXIXBKD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The IUPAC name of [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol (CID 66362374) is [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol.
What is the SMILES notation for [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The canonical SMILES for [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is Cn1c(CO)cnc1SCC1Cc2cc(Br)ccc2O1.
What is the InChIKey of [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
The InChIKey is FJPQJXGHXIXBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2S/c1-17-11(7-18)6-16-14(17)20-8-12-5-9-4-10(15)2-3-13(9)19-12/h2-4,6,12,18H,5,7-8H2,1H3.
What are the key properties of [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol?
[2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol has a molecular weight of 355.26 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methylsulfanyl]-3-methylimidazol-4-yl]methanol is sourced from PubChem (CID 66362374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).