C28H34N4O2 — CID 6636365
1-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-[6-(4-methoxyphenyl)-3,4-dihydro-2H-1,5-naphthyridin-1-yl]propan-2-ol (PubChem CID 6636365) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-[6-(4-methoxyphenyl)-3,4-dihydro-2H-1,5-naphthyridin-1-yl]propan-2-ol.
| Compound Name | 1-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-[6-(4-methoxyphenyl)-3,4-dihydro-2H-1,5-naphthyridin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 6636365 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-(6,7-dimethyl-3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-[6-(4-methoxyphenyl)-3,4-dihydro-2H-1,5-naphthyridin-1-yl]propan-2-ol |
| SMILES | COc1ccc(-c2ccc3c(n2)CCCN3CC(O)CN2CCCc3nc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C28H34N4O2/c1-19-16-28-26(29-20(19)2)7-5-15-32(28)18-22(33)17-31-14-4-6-25-27(31)13-12-24(30-25)21-8-10-23(34-3)11-9-21/h8-13,16,22,33H,4-7,14-15,17-18H2,1-3H3 |
| InChIKey | WTTDZBWUFFBFJV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |