C22H24N2O2 — CID 6636370
(3R,6S,7S,9aS)-3-benzyl-7-methyl-6-phenyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 6636370) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (3R,6S,7S,9aS)-3-benzyl-7-methyl-6-phenyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,6S,7S,9aS)-3-benzyl-7-methyl-6-phenyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 6636370 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3R,6S,7S,9aS)-3-benzyl-7-methyl-6-phenyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1CC[C@H]2C(=O)N[C@H](Cc3ccccc3)C(=O)N2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-15-12-13-19-21(25)23-18(14-16-8-4-2-5-9-16)22(26)24(19)20(15)17-10-6-3-7-11-17/h2-11,15,18-20H,12-14H2,1H3,(H,23,25)/t15-,18+,19-,20-/m0/s1 |
| InChIKey | LCEPWRZCGOJERG-LDTOTXGLSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |