C30H41NO8 — CID 6636465
(6R,7S,11S,14S,15R,19S)-7,15-dimethoxy-6,14-dimethyl-11-phenylmethoxy-9,17-dioxa-1-azabicyclo[17.3.0]docosa-4,12-diene-2,10,18-trione (PubChem CID 6636465) has the molecular formula C30H41NO8 and a molecular weight of 543.66 g/mol. Its IUPAC name is (6R,7S,11S,14S,15R,19S)-7,15-dimethoxy-6,14-dimethyl-11-phenylmethoxy-9,17-dioxa-1-azabicyclo[17.3.0]docosa-4,12-diene-2,10,18-trione.
| Compound Name | (6R,7S,11S,14S,15R,19S)-7,15-dimethoxy-6,14-dimethyl-11-phenylmethoxy-9,17-dioxa-1-azabicyclo[17.3.0]docosa-4,12-diene-2,10,18-trione |
|---|---|
| PubChem CID | 6636465 |
| Molecular Formula | C30H41NO8 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | (6R,7S,11S,14S,15R,19S)-7,15-dimethoxy-6,14-dimethyl-11-phenylmethoxy-9,17-dioxa-1-azabicyclo[17.3.0]docosa-4,12-diene-2,10,18-trione |
| SMILES | CO[C@H]1COC(=O)[C@@H]2CCCN2C(=O)CC=C[C@@H](C)[C@H](OC)COC(=O)[C@@H](OCc2ccccc2)C=C[C@@H]1C |
| InChI | InChI=1S/C30H41NO8/c1-21-10-8-14-28(32)31-17-9-13-24(31)29(33)38-19-27(36-4)22(2)15-16-25(30(34)39-20-26(21)35-3)37-18-23-11-6-5-7-12-23/h5-8,10-12,15-16,21-22,24-27H,9,13-14,17-20H2,1-4H3/t21-,22+,24+,25+,26-,27+/m1/s1 |
| InChIKey | BSNPSCNZVCCRLH-QBFVLSMSSA-N |
| XLogP | 3.47 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|