C15H13ClFNO2 — CID 66364663
5-chloro-2-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline (PubChem CID 66364663) has the molecular formula C15H13ClFNO2 and a molecular weight of 293.73 g/mol. Its IUPAC name is 5-chloro-2-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline.
| Compound Name | 5-chloro-2-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline |
|---|---|
| PubChem CID | 66364663 |
| Molecular Formula | C15H13ClFNO2 |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-chloro-2-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methoxy]aniline |
| SMILES | Nc1cc(Cl)ccc1OCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H13ClFNO2/c16-10-1-3-15(13(18)7-10)19-8-12-6-9-5-11(17)2-4-14(9)20-12/h1-5,7,12H,6,8,18H2 |
| InChIKey | GBVIGJWISXIYHV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|