C21H33NO6S — CID 6636483
(3S,9S,10R,17R)-10-methoxy-9,17-dimethyl-3-(2-methylsulfanylethyl)-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione (PubChem CID 6636483) has the molecular formula C21H33NO6S and a molecular weight of 427.56 g/mol. Its IUPAC name is (3S,9S,10R,17R)-10-methoxy-9,17-dimethyl-3-(2-methylsulfanylethyl)-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione.
| Compound Name | (3S,9S,10R,17R)-10-methoxy-9,17-dimethyl-3-(2-methylsulfanylethyl)-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione |
|---|---|
| PubChem CID | 6636483 |
| Molecular Formula | C21H33NO6S |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (3S,9S,10R,17R)-10-methoxy-9,17-dimethyl-3-(2-methylsulfanylethyl)-1,12-dioxa-4-azacyclooctadeca-7,15-diene-2,5,13-trione |
| SMILES | CO[C@H]1COC(=O)CC=C[C@@H](C)COC(=O)[C@H](CCSC)NC(=O)CC=C[C@@H]1C |
| InChI | InChI=1S/C21H33NO6S/c1-15-7-5-10-20(24)27-14-18(26-3)16(2)8-6-9-19(23)22-17(11-12-29-4)21(25)28-13-15/h5-8,15-18H,9-14H2,1-4H3,(H,22,23)/t15-,16+,17+,18+/m1/s1 |
| InChIKey | RFULMJQZKAYMPR-OWSLCNJRSA-N |
| XLogP | 2.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|