C16H22O6 — CID 6636553
(1R,5S,12R,13S,16R)-16-hydroxy-5,12-dimethyl-3,7,17-trioxabicyclo[11.3.1]heptadeca-10,14-diene-4,8-dione (PubChem CID 6636553) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1R,5S,12R,13S,16R)-16-hydroxy-5,12-dimethyl-3,7,17-trioxabicyclo[11.3.1]heptadeca-10,14-diene-4,8-dione.
| Compound Name | (1R,5S,12R,13S,16R)-16-hydroxy-5,12-dimethyl-3,7,17-trioxabicyclo[11.3.1]heptadeca-10,14-diene-4,8-dione |
|---|---|
| PubChem CID | 6636553 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1R,5S,12R,13S,16R)-16-hydroxy-5,12-dimethyl-3,7,17-trioxabicyclo[11.3.1]heptadeca-10,14-diene-4,8-dione |
| SMILES | C[C@@H]1C=CCC(=O)OC[C@H](C)C(=O)OC[C@H]2O[C@H]1C=C[C@H]2O |
| InChI | InChI=1S/C16H22O6/c1-10-4-3-5-15(18)20-8-11(2)16(19)21-9-14-12(17)6-7-13(10)22-14/h3-4,6-7,10-14,17H,5,8-9H2,1-2H3/t10-,11+,12-,13+,14-/m1/s1 |
| InChIKey | AOMFZMKHFOCBRU-XHJNMGKDSA-N |
| XLogP | 0.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|