C13H14Cl2O2 — CID 66366424
3-(2,6-dichlorophenoxy)-2-ethyl-2-methylcyclobutan-1-one (PubChem CID 66366424) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 3-(2,6-dichlorophenoxy)-2-ethyl-2-methylcyclobutan-1-one.
| Compound Name | 3-(2,6-dichlorophenoxy)-2-ethyl-2-methylcyclobutan-1-one |
|---|---|
| PubChem CID | 66366424 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-(2,6-dichlorophenoxy)-2-ethyl-2-methylcyclobutan-1-one |
| SMILES | CCC1(C)C(=O)CC1Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2O2/c1-3-13(2)10(16)7-11(13)17-12-8(14)5-4-6-9(12)15/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | QGDVYZLYZBJDQL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |