C21H31NO6 — CID 6636689
(6R,7R,14R,18R)-7-methoxy-6,14-dimethyl-9,16-dioxa-1-azabicyclo[16.3.0]henicosa-4,12-diene-2,10,17-trione (PubChem CID 6636689) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is (6R,7R,14R,18R)-7-methoxy-6,14-dimethyl-9,16-dioxa-1-azabicyclo[16.3.0]henicosa-4,12-diene-2,10,17-trione.
| Compound Name | (6R,7R,14R,18R)-7-methoxy-6,14-dimethyl-9,16-dioxa-1-azabicyclo[16.3.0]henicosa-4,12-diene-2,10,17-trione |
|---|---|
| PubChem CID | 6636689 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (6R,7R,14R,18R)-7-methoxy-6,14-dimethyl-9,16-dioxa-1-azabicyclo[16.3.0]henicosa-4,12-diene-2,10,17-trione |
| SMILES | CO[C@H]1COC(=O)CC=C[C@@H](C)COC(=O)[C@H]2CCCN2C(=O)CC=C[C@H]1C |
| InChI | InChI=1S/C21H31NO6/c1-15-7-4-11-20(24)27-14-18(26-3)16(2)8-5-10-19(23)22-12-6-9-17(22)21(25)28-13-15/h4-5,7-8,15-18H,6,9-14H2,1-3H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | XWWBVVBSGQSUTO-TVFCKZIOSA-N |
| XLogP | 2.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|