About 3-methoxy-2,2-dimethylcyclobutan-1-ol
3-methoxy-2,2-dimethylcyclobutan-1-ol (PubChem CID 66366890) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethylcyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-methoxy-2,2-dimethylcyclobutan-1-ol |
| PubChem CID | 66366890 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 3-methoxy-2,2-dimethylcyclobutan-1-ol |
| SMILES | COC1CC(O)C1(C)C |
| InChI | InChI=1S/C7H14O2/c1-7(2)5(8)4-6(7)9-3/h5-6,8H,4H2,1-3H3 |
| InChIKey | KPEQWKNUQXHLHA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,2-dimethylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,2-dimethylcyclobutan-1-ol?
The IUPAC name of 3-methoxy-2,2-dimethylcyclobutan-1-ol (CID 66366890) is 3-methoxy-2,2-dimethylcyclobutan-1-ol.
What is the SMILES notation for 3-methoxy-2,2-dimethylcyclobutan-1-ol?
The canonical SMILES for 3-methoxy-2,2-dimethylcyclobutan-1-ol is COC1CC(O)C1(C)C.
What is the InChIKey of 3-methoxy-2,2-dimethylcyclobutan-1-ol?
The InChIKey is KPEQWKNUQXHLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-7(2)5(8)4-6(7)9-3/h5-6,8H,4H2,1-3H3.
What are the key properties of 3-methoxy-2,2-dimethylcyclobutan-1-ol?
3-methoxy-2,2-dimethylcyclobutan-1-ol has a molecular weight of 130.19 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,2-dimethylcyclobutan-1-ol is sourced from PubChem (CID 66366890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).