About 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol
3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol (PubChem CID 66367119) has the molecular formula C14H15I3O2
and a molecular weight of 595.98 g/mol. Its IUPAC name is 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol.
Molecular Properties
| Compound Name | 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol |
| PubChem CID | 66367119 |
| Molecular Formula | C14H15I3O2 |
| Molecular Weight | 595.98 g/mol |
| Exact Mass | 595.82 |
| IUPAC Name | 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol |
| SMILES | OC1CC(Oc2c(I)cc(I)cc2I)C12CCCC2 |
| InChI | InChI=1S/C14H15I3O2/c15-8-5-9(16)13(10(17)6-8)19-12-7-11(18)14(12)3-1-2-4-14/h5-6,11-12,18H,1-4,7H2 |
| InChIKey | DPZBNIQLBFXQMS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 595.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol?
The IUPAC name of 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol (CID 66367119) is 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol.
What is the SMILES notation for 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol?
The canonical SMILES for 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol is OC1CC(Oc2c(I)cc(I)cc2I)C12CCCC2.
What is the InChIKey of 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol?
The InChIKey is DPZBNIQLBFXQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15I3O2/c15-8-5-9(16)13(10(17)6-8)19-12-7-11(18)14(12)3-1-2-4-14/h5-6,11-12,18H,1-4,7H2.
What are the key properties of 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol?
3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol has a molecular weight of 595.98 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4,6-triiodophenoxy)spiro[3.4]octan-1-ol is sourced from PubChem (CID 66367119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).